Kokusaginine | MedChemExpress (MCE)
Kokusaginine is a furoquinoline alkaloids, which exhibits inhibitory efficacy for acetylcholinesterase (AChE) with an IC50 of 28.2 μM. Kokusaginine exhibits anti-proliferative and apoptotic inducing effects in MCF-7/ADR cells[1][2].
| Trivial name | Kokusaginine |
| Catalog Number | HY-114803 |
| Research Area | Neurological Disease; Cancer |
| CAS# | 484-08-2 |
| Purity | ≥98.0% |
| SMILES | COC1=C(C=C2C(OC)=C3C(OC=C3)=NC2=C1)OC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kokusaginine.html |