Sphondin
Sphondin, a natural product isolated and purified from the fruits of Heracleum sibiricum L., possesses an inhibitory effect on IL-1beta-induced increase in the level of COX-2 protein and PGE(2) release in A549 cells.
| Trivial name | / |
| Catalog Number | CSN13982 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C12H8O4 |
| CAS# | 483-66-9 |
| Purity | ≥99% |
| SMILES | O=C1C=CC2=CC(OC)=C(OC=C3)C3=C2O1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/sphondin.html |