Δ7(Z)-C14-HSL | MedChemExpress (MCE)
Δ7(Z)-C14-HSL (Compound 12) is an immunosuppressive agent that can inhibit the proliferation of mouse splenic cells with an IC50 of 17 μM. Δ7(Z)-C14-HSL can be used for further studying its potential as a molecular mechanism in TNF-R-driven immune diseases, especially autoimmune diseases such as psoriasis, rheumatoid arthritis, and type 1 diabetes[1].
| Trivial name | Δ7(Z)-C14-HSL |
| Catalog Number | HY-145492 |
| Alternative Name(s) | N-(3-Oxo-7Z-tetradecenoyl)-L-homoserine lactone |
| Research Area | Inflammation/Immunology |
| CAS# | 482598-46-9 |
| Purity | ≥98.0% |
| SMILES | CCCCCC/C=C\CCCC(CC(N[C@@H]1C(OCC1)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/7-z-c14-hsl.html |