Isobergapten
Fine Chemicals
| Trivial name | NULL |
| Catalog Number | CS-O-16768 |
| Alternative Name(s) | 5-Methoxy-2H-furo[2,3-H]chromen-2-one |
| Research Area | Isobergapten shows anti-proliferative activity and causes G2/M arrest at concentrations of 0.05-15.0 μM. Isobergapten is the principal constituents responsible for the antimycobacterial activity of the roots of Heracleum maximum |
| Molecular Formula | C12H8O4 |
| CAS# | 482-48-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=C2C=CC(=O)OC2=C3C=COC3=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16768.html |
| Additional Information | NULL |