Hyperoside
Hyperoside, a natural product isolated and purified from the herb of Hypericum perforatum L., with neuro-protective, anti-inflammatory and antioxidative effects, promotes ECV304 cell proliferation, may cause herb-drug interactions when co-administrated with CYP2D substrates and serve as a protective agent by alleviating microglia activation in disorders such as Parkinson’s disease.
| Trivial name | Hyperin; Quercetin-3-O-β-D-Galactoside; Quercetin-3-O-beta-D-Galactoside |
| Catalog Number | CSN16368 |
| Alternative Name(s) | Hyperin; Quercetin-3-O-β-D-Galactoside; Quercetin-3-O-beta-D-Galactoside |
| Research Area | Immunology/Inflammation|Neurological Disease |
| Molecular Formula | C21H20O12 |
| CAS# | 482-36-0 |
| Purity | ≥98% |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@H]([C@H]([C@@H](CO)O2)O)O)O)=C(C3=CC=C(O)C(O)=C3)OC4=CC(O)=CC(O)=C14 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/hyperoside.html |