Byacangelicin
Byakangelicin, a main furanocoumarin constituent isolated and characterized as an aldose reductase inhibitor from the roots of Angelica dahurica, is an aldose reductase inhibitor and induces cytochrome P450 3A4 expression via transactivation of pregnane X receptors in human hepatocytes.
| Trivial name | Biacangelicin |
| Catalog Number | CSN15661 |
| Alternative Name(s) | Biacangelicin |
| Research Area | / |
| Molecular Formula | C17H18O7 |
| CAS# | 482-25-7 |
| Purity | ≥99% |
| SMILES | CC([C@@](O)([H])COC1=C2C(C=CC(O2)=O)=C(OC)C3=C1OC=C3)(O)C |
| Size | 2mg |
| Supplier Page | https://www.csnpharm.com/products/byacangelicin.html |