Hydroxy Metronidazole D2
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-13596 |
| Alternative Name(s) | 2-[2-(hydroxymethyl)-5-nitro-1H-imidazol-1-yl](1,1-D2)ethan-1-ol |
| Research Area | Labeled Metronidazole metabolite, intended for use as an internal standard for the quantification of Metronidazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H7N3O4D2 |
| CAS# | 4812-40-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OCCN1C([N](=O)=O)=CN=C1C([2H])([2H])O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13596.html |
| Additional Information | NULL |