Plumbagin
Plumbagin is an anticancer agent, induces G2/M cell cycle arrest and apoptosis in A549 cells through JNK-dependent p53 Ser15 phosphorylation and inhibits A549 and MDA-MD-231 tumour xenograft growth in nude mice.
| Trivial name | Plumbagine; Plumbaein; Plumbagone |
| Catalog Number | CSN19860 |
| Alternative Name(s) | Plumbagine; Plumbaein; Plumbagone |
| Research Area | Cancer |
| Molecular Formula | C11H8O3 |
| CAS# | 481-42-5 |
| Purity | ≥99% |
| SMILES | O=C(C1=C2C=CC=C1O)C=C(C)C2=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/plumbagin.html |
