Naringenin 5mg
Naringenin is a flavanone, a type of flavonoid, that is considered to have a bioactive effect on human health as antioxidant, free radical scavenger, anti-inflammatory, carbohydrate metabolism promoter, and immune system modulator.
| Trivial name | Naringenin 5mg |
| Catalog Number | A10625-5 |
| Alternative Name(s) | 5,7-dihydroxy-2-(4-hydroxyphenyl)chroman-4-one |
| Molecular Formula | C15H12O5 |
| CAS# | 480-41-1 |
| SMILES | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/naringenin.html |