(+)-Pinocembrin
(+)-Pinocembrin could inhibit p53 expression causing a lower Bax/Bcl-2 ratio and the release of cytochrome c that shows a neuroprotective effects. (+)-Pinocembrin can be extracted from the fruit of alpinia katsunadia hayata with antioxidant and anti-inflammatory antivities.
| Trivial name | Dihydrochrysin; Galangin flavanone; 5,7-Dihydroxyflavanone |
| Catalog Number | CSN15662 |
| Alternative Name(s) | Dihydrochrysin; Galangin flavanone; 5,7-Dihydroxyflavanone |
| Research Area | Immunology/Inflammation|Neurological Disease |
| Molecular Formula | C15H12O4 |
| CAS# | 480-39-7 |
| Purity | ≥99% |
| SMILES | O=C1C[C@@H](C2=CC=CC=C2)OC3=CC(O)=CC(O)=C13 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/(+)-pinocembrin.html |