Oroxylin A
Oroxylin A shows inhibition of the dopamine reuptake and allosteric modulation of GABAA receptor. It is a natural active flavonoid isolated from scutellaria baicalensis and oroxylum indicum.
| Trivial name | 6-Methoxybaicalein |
| Catalog Number | CSN11617 |
| Alternative Name(s) | 6-Methoxybaicalein |
| Research Area | Cancer |
| Molecular Formula | C16H12O5 |
| CAS# | 480-11-5 |
| Purity | ≥99% |
| SMILES | COC1=C(C=C2C(=C1O)C(=O)C=C(O2)C3=CC=CC=C3)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/oroxylin-a.html |