R-1479
R-1479 (4′-Azidocytidine), a nucleoside analogue, is a specific inhibitor of RNA-dependent RNA polymerase (RdRp) of HCV. R-1479 inhibits HCV replication in the HCV subgenomic replicon system (IC50=1.28 μM). R-1479 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
Trivial name | 4'-Azidocytidine |
Catalog Number | E7517 |
Molecular Formula | C18H14Cl4N2O.HNO3 |
CAS# | 478182-28-4 |
Inchi | InChI=1S/C18H14Cl4N2O.HNO3/c19-13-2-1-12(16(21)7-13)10-25-18(9-24-6-5-23-11-24)15-4-3-14(20)8-17(15)22;2-1(3)4/h1-8,11,18H,9-10H2;(H,2,3,4) |
Inchi Key | MCCACAIVAXEFAL-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)Cl)COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl.[N+](=O)(O)[O-] |
Size | 1mg |
Supplier Page | http://www.selleckchem.com/products/r-1479.html |
Additional Information | https://file.selleck.cn/downloads/struct/e7517-r-1479-chemical-structure-tube.png |