Rhein
Rhein is a lipophilic anthraquinone extensively found in medicinal herbs, and has many pharmacological effects, including epatoprotective, nephroprotective, anti-inflammatory, antioxidant, anticancer, and antimicrobial activities.
| Trivial name | Monorhein; NSC-38629; Rheinic Acid; Rheic Acid |
| Catalog Number | CSN19356 |
| Alternative Name(s) | Monorhein; NSC-38629; Rheinic Acid; Rheic Acid |
| Research Area | / |
| Molecular Formula | C15H8O6 |
| CAS# | 478-43-3 |
| Purity | ≥98% |
| SMILES | O=C(C(C=C1C2=O)=CC(O)=C1C(C3=C2C=CC=C3O)=O)O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/rhein.html |