Rhein
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-41737 |
| Alternative Name(s) | 4,5-Dihydroxyanthraquinone-2-carboxylic acid;9,10-Dihydro-4,5-dihydroxy-9,10-dioxo-2-antcid;4,5-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid |
| Research Area | Found in the free state and as glucoside in Rheum spp, Polygonaceae (rhubarb) and in Senna leaves. |
| Molecular Formula | C15H8O6 |
| CAS# | 478-43-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C1=CC=C2)=C2O)C(C(O)=CC(C(O)=O)=C3)=C3C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST41737.html |
| Additional Information | NULL |