Isotretinoin 10mM * 1mL in DMSO
Isotretinoin was developed to be used as a chemotherapy medication for the treatment of brain cancer, pancreatic cancer and more.
Trivial name | Isotretinoin 10mM * 1mL in DMSO |
Catalog Number | A10485-10mM-D |
Alternative Name(s) | (2Z,4E,6E,8E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenoic Acid |
Molecular Formula | C20H28O2 |
CAS# | 4759-48-2 |
SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=CC(=O)O)/C)/C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/isotretinoin.html |