NVP-AEW541 25mg
NVP-AEW541 is a selective IGF-1R kinase inhibitor that inhibits the autophosphorylation activity of IGF-1R (IC50 = 0.086 uM) and prevents IGF-1-mediated survival and proliferation of MCF-7 cells (IC50 = 0.16 and 1.64 uM, respectively).
| Trivial name | NVP-AEW541 25mg |
| Catalog Number | A11021-25 |
| Alternative Name(s) | 7-?€?[cis-?€?3-?€?(1-?€?azetidinylmethyl)cyclobutyl]-?€?5-?€?[3-?€?(phenylmethoxy)phenyl]-?€?7H-?€?pyrrolo[2,?€?3-?€?d]pyrimidin-?€?4-?€?amine |
| Molecular Formula | C27H29N5O |
| CAS# | 475489-16-8 |
| SMILES | C1CN(C1)CC2CC(C2)N3C=C(C4=C3N=CN=C4N)C5=CC(=CC=C5)OCC6=CC=CC=C6 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/nvp-aew541.html |
