A-317491 sodium salt hydrate 10mg
A-317491 sodium salt hydrate is a non-nucleotide P2X3 and P2X2/3 receptor antagonist, which inhibits calcium flux mediated by the receptors.
Trivial name | A-317491 sodium salt hydrate 10mg |
Catalog Number | A12412-10 |
Alternative Name(s) | (S)-5-((3-phenoxybenzyl)(1,2,3,4-tetrahydronaphthalen-1-yl)carbaMoyl)benzene-1,2,4-tricarboxylic acid |
Molecular Formula | C33H27N1O8 |
CAS# | 475205-49-3 |
SMILES | C1C[C@@H](C2=CC=CC=C2C1)N(CC3=CC(=CC=C3)OC4=CC=CC=C4)C(=O)C5=CC(=C(C=C5C(=O)O)C(=O)O)C(=O)O |
Size | 10mg |
Supplier Page | http://www.adooq.com/a-317491-sodium-salt-hydrate.html |