Tivozanib
Tivozanib is a potent and selective VEGFR inhibitor for VEGFR1/2/3 with IC50 of 30 nM/6.5 nM/15 nM, and also inhibits PDGFR and c-Kit, low activity observed against FGFR-1, Flt3, c-Met, EGFR and IGF-1R. Phase 3.
| Trivial name | AV-951, KRN-951 |
| Catalog Number | S1207 |
| Molecular Formula | C19H28N2O2 |
| CAS# | 475108-18-0 |
| Inchi | InChI=1S/C19H28N2O2/c22-19(17-13-18(23-20-17)14-11-12-14)21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h13-16H,1-12H2 |
| Inchi Key | NDKGACIWVAOUQH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N(C2CCCCC2)C(=O)C3=NOC(=C3)C4CC4 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/AV-951.html |
| Additional Information | https://file.selleck.cn/downloads/struct/AV-951-Tivozanib-chemical-structure-S1207.gif |
