Tivozanib (AV-951) 10mM * 1mL in DMSO
Tivozanib (AV-951) is an oral VEGF receptor tyrosine kinase inhibitor that is designed to inhibit all three VEGF receptors.
| Trivial name | Tivozanib (AV-951) 10mM * 1mL in DMSO |
| Catalog Number | A10101-10mM-D |
| Alternative Name(s) | 1-{2-Chloro-4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-3-(5-methylisoxazol-3-yl)urea |
| Molecular Formula | C22H19ClN4O5 |
| CAS# | 475108-18-0 |
| SMILES | CC1=CC(=NO1)NC(=O)NC2=C(C=C(C=C2)OC3=C4C=C(C(=CC4=NC=C3)OC)OC)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tivozanib-av-951.html |