NS-304 25mg
NS-304 is a selective prostacyclin IP1 receptor agonist (Ki values are 260 and 2100 nM and for human and rat IP receptors, and >10 ??M for EP1-4, DP, FP, and TP receptors).
| Trivial name | NS-304 25mg |
| Catalog Number | A13880-25 |
| Alternative Name(s) | 2-[4-[(5,6-Diphenyl-2-pyrazinyl)(1-methylethyl)amino]butoxy]-N-(methylsulfonyl)acetamide |
| Molecular Formula | C26H32N4O4S |
| CAS# | 475086-01-2 |
| SMILES | CC(C)N(CCCCOCC(=O)NS(=O)(=O)C)C1=CN=C(C(=N1)C2=CC=CC=C2)C3=CC=CC=C3 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/ns-304.html |
