(±)-NBI-74330 | MedChemExpress (MCE)
(±)-NBI-74330 is a potent and selective CXCR3 antagonist. (±)-NBI-74330 not only reduces tactile and thermal hypersensitivity but also enhances the analgesic properties of morphine. (±)-NBI-74330 can reduce microglial cell activation, increase astroglial cell activation, and downregulate the expression of some CXCR3 ligands in a rat neuropathic pain model[1].
| Trivial name | (±)-NBI-74330 |
| Catalog Number | HY-110099 |
| Research Area | Inflammation/Immunology |
| CAS# | 473722-68-8 |
| Purity | ≥98.00% |
| SMILES | O=C1C2=C(N=C(C(C)N(CC3=CC=CN=C3)C(CC4=CC=C(C(C(F)(F)F)=C4)F)=O)N1C5=CC=C(C=C5)OCC)N=CC=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-nbi-74330.html |