Astaxanthin
API Standard
| Catalog Number | CS-O-00913 |
| Alternative Name(s) | (6S,6'S)-3,3'((1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaene-1,18-diyl)bis(6-hydroxy-2,4,4-trimethylcyclohex-2-enone) |
| Research Area | Carotenoid pigment found mostly in animal organisms, but also occuring in plants; thought to be the precursor of astacin. Animal studies indicate that it reduces blood glucose and ameliorates several parameters of the diabetic metabolic syndrome. It impro |
| Molecular Formula | C40H52O4 |
| CAS# | 472-61-7 |
| Purity | >98% |
| SMILES | CC(/C=C/C(C(C)(C[C@H](O)C1=O)C)=C1C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC(C(C)(C[C@H](O)C2=O)C)=C2C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00913.html |