Masticadienolic acid | MedChemExpress (MCE)
Masticadienolic acid is an antitumor agent via increasing the production of nitric oxide (NO). Masticadienolic acid also increases the release of NO in resting macrophages[1].
| Trivial name | Masticadienolic acid |
| Catalog Number | HY-N3313 |
| Research Area | Cancer |
| CAS# | 472-30-0 |
| Purity | ≥98.00% |
| SMILES | C[C@@]12C3=CC[C@](C(C)([C@H](CC4)O)C)([H])[C@@]4(C)[C@@]3([H])CC[C@]1([C@](CC2)([H])[C@@H](C)CC/C=C(C)\C(O)=O)C |
| PubChem Chemical Structure ID | 102004474 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/masticadienolic-acid.html |