MK-0752 10mM * 1mL in DMSO
MK-0752 inhibits the Notch signaling pathway, which may result in induction of growth arrest and apoptosis in tumor cells in which the Notch signaling pathway is overactivated.
| Trivial name | MK-0752 10mM * 1mL in DMSO |
| Catalog Number | A11194-10mM-D |
| Alternative Name(s) | cis-4-[(4-Chlorophenyl)sulfonyl]-4-(2,5-difluorophenyl)cyclohexanepropanoic acid |
| Molecular Formula | C21H21ClF2O4S |
| CAS# | 471905-41-6 |
| SMILES | C1CC(CCC1CCC(=O)O)(C2=C(C=CC(=C2)F)F)S(=O)(=O)C3=CC=C(C=C3)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/mk-0752.html |