(S)-1,1-Dimethylpyrrolidin-1-ium-2-carboxylate
Stachydrine is a major constituent of Chinese herb leonurus heterophyllus sweet used to promote blood circulation and dispel blood stasis.
Stachydrine can inhibit the NF-κB signal pathway.
| Trivial name | / |
| Catalog Number | CSN23322 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C7H13NO2 |
| CAS# | 471-87-4 |
| Purity | ≥95% |
| SMILES | O=C([C@H]1[N+](C)(C)CCC1)[O-] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/(s)-1,1-dimethylpyrrolidin-1-ium-2-carboxylate.html |