Enoxolone
major component of licorice Others|Others
| Catalog Number | B5986-1000 |
| Research Area | Others|Others |
| Molecular Formula | C30H46O4 |
| CAS# | 471-53-4 |
| Purity | 99.25% |
| SMILES | CC([C@]1([H])CC[C@]23C)([C@](O)([H])CC[C@@]1([C@@]2([H])C(C=C4[C@]5([H])C[C@](CC[C@](CC[C@]43C)5C)(C(O)=O)C)=O)C)C |
| Size | 1g |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B5986 |
