Zerumbone 100mg
Zerumbone is a natural monocyclic sesquiterpene first isolated from rhizomes of the wild ginger Z. zerumbet.1 It potently inhibits the activation of Epstein-Barr virus by phorbol esters (IC50 = 140 nM).
| Trivial name | Zerumbone 100mg |
| Catalog Number | A13703-100 |
| Alternative Name(s) | (2E,6E)-2,6,9,9-tetramethyl-2,6,10E-cycloundecatrien-1-one |
| Molecular Formula | C15H22O |
| CAS# | 471-05-6 |
| SMILES | C/C/1=CCC(/C=C/C(=O)/C(=C/CC1)/C)(C)C |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/zerumbone.html |
