alpha-Lapachone
alpha-Lapachone, a natural product isolated and purified from the barks of Catalpa ovata, does not induce H₂O₂ formmation but shows an approximately the same trypanocidal activity of beta-lapachone.
| Trivial name | α-Lapachone |
| Catalog Number | CSN14071 |
| Alternative Name(s) | α-Lapachone |
| Research Area | / |
| Molecular Formula | C15H14O3 |
| CAS# | 4707-33-9 |
| Purity | ≥98% |
| SMILES | O=C(C1=C2OC(C)(C)CC1)C3=C(C2=O)C=CC=C3 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/alpha-lapachone.html |