β-Lapachone
β-Lapachone is a naturally occurring quinone obtained from the bark of the lapacho tree (Tabebuia avellanedae) with cancer chemopreventive properties and a potent inhibitor of IDO1 (IC50=0.44 μM).
| Trivial name | ARQ-501; NSC 26326; NSC629749 |
| Catalog Number | CSN12283 |
| Alternative Name(s) | ARQ-501; NSC 26326; NSC629749 |
| Research Area | Cancer |
| Molecular Formula | C15H14O3 |
| CAS# | 4707-32-8 |
| Purity | ≥99% |
| SMILES | O=C1C(CCC(C)(C)O2)=C2C3=CC=CC=C3C1=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/b-lapachone.html |