Orphenadrine citrate 10mM * 1mL in DMSO
Orphenadrine is known to have the following pharmacology: mACh receptor antagonist (anticholinergic); H1 receptor antagonist (antihistamine); NMDA receptor antagonist; NET blocker (norepinephrine reuptake inhibitor); Nav1.7, Nav1.8, and Nav1.9 sodium channel blocker; HERG potassium channel blocker.
Trivial name | Orphenadrine citrate 10mM * 1mL in DMSO |
Catalog Number | A11712-10mM-D |
Alternative Name(s) | N/A |
Molecular Formula | C₁₈H₂₃NO.C₆H₈O₇ |
CAS# | 4682-36-4 |
SMILES | CC1=CC=CC=C1C(C2=CC=CC=C2)OCCN(C)C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/orphenadrine-citrate.html |