Fusidic acid EP Impurity G
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-20065 |
| Alternative Name(s) | ent-(17Z)-16α-(Acetyloxy)-11β-hydroxy-4β,8,14-trimethyl-3-oxo-18-nor-5β,10α-cholesta-17(20),24-dien-21-oic acid ;3-Keto Fusidic Acid ;3-Didehydro Fusidic Acid ;Sodium Fusidate EP Impurity G ; |
| Research Area | Impurity of Fusidic acid;Impurity in commercial preparations of Fusidic Acid |
| Molecular Formula | C31H46O6 |
| CAS# | 4680-37-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]([C@]([C@H](O)C1)([H])[C@]2(CCC3=O)C)(CC[C@@]2([H])[C@@H]3C)[C@]([C@]1([H])/C4=C(C(O)=O)CC/C=C(C)C)(C[C@@H]4OC(C)=O)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO20065.html |
| Additional Information | NULL |