(+)-Nootkatone
(+)-nootkatone, a bicyclic conjugated sesquiterpene ketone with a grapefruit-like flavor, is commonly used in fragrance, food, cosmetics and pharmaceutical industry. It can be synthesized from (+)-valencene via biotransformation. (+)-nootkatone is the active ingredient responsible for the antiplatelet effect of Cyperus rotundus, a well-known oriental traditional medicine. It also shows promising efficacy against Staphylococcus aureus biofilms.
| Catalog Number | CBB1114936 |
| Molecular Formula | C15H22O |
| CAS# | 4674-50-4 |
| Purity | >99% |
| Inchi | 1S/C15H22O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11-12H,1,5-7,9H2,2-4H3/t11-,12-,15+/m1/s1 |
| Inchi Key | WTOYNNBCKUYIKC-JMSVASOKSA-N |
| SMILES | C[C@@H]1CC(=O)C=C2CC[C@H](C[C@@]12C)C(C)=C |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/nootkatone-item-114936.html |
