Theaflavin
Theaflavin, a type of thearubigins, exhibits inhibition of xanthine oxidase enzyme and can scavenge various oxidation radicals with anti-oxidant and anti-tumor activities. It can be purified from the leaves of Camellia sinensis (L.) O. Kuntze.
| Trivial name | Theaflavine |
| Catalog Number | CSN12074 |
| Alternative Name(s) | Theaflavine |
| Research Area | Infection |
| Molecular Formula | C29H24O12 |
| CAS# | 4670-05-7 |
| Purity | ≥98% |
| SMILES | O=C1C(O)=CC([C@@H]2[C@H](O)CC3=C(O2)C=C(O)C=C3O)=CC4=C([C@@H]5[C@H](O)CC6=C(O5)C=C(O)C=C6O)C=C(O)C(O)=C41 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/theaflavin.html |