Hecogenin
Hecogenin is a natural product isolated and purified from the roots of Aconitum carmichaeli Debx with antioxidant and anti-inflammatory properties, which can protect gastro by K⁺(ATP) channels opening and the COX-2/PG pathway.
| Trivial name | Hocogenin |
| Catalog Number | CSN19362 |
| Alternative Name(s) | Hocogenin |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C27H42O4 |
| CAS# | 467-55-0 |
| Purity | ≥98% |
| SMILES | [H][C@]1(O[C@@]2(OC[C@H](C)CC2)[C@@H](C)[C@@]1([C@]34C)[H])C[C@@]3([H])[C@]5([H])CC[C@@]6([H])C[C@@H](O)CC[C@]6(C)[C@@]5([H])CC4=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/hecogenin.html |