Bufalin
Bufalin a major digoxin-like immunoreactive component of the Chinese medicine Chan Su and has been shown to exert a potential for anticancer activity against various human cancer cell lines in vitro.
| Trivial name | / |
| Catalog Number | CSN19435 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C24H34O4 |
| CAS# | 465-21-4 |
| Purity | ≥99% |
| SMILES | O=C(C=C1)OC=C1[C@H]2CC[C@]3(O)[C@]4([H])CC[C@]5([H])C[C@@H](O)CC[C@]5(C)[C@@]4([H])CC[C@@]32C |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/bufalin.html |