Oleandrin
Oleandrin, a natural product isolated and purified from the herbs of Nerium oleander L., inhibits the activity of NF-κB in various cultured cell lines (U937, CaOV3, human epithelial cells and T cells) as well as it induces programmed cell death in PC3 cell line culture.
| Trivial name | / |
| Catalog Number | CSN11601 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C32H48O9 |
| CAS# | 465-16-7 |
| Purity | ≥98% |
| SMILES | O=C1OCC([C@H]2[C@@H](OC(C)=O)C[C@]3(O)[C@]4([H])CC[C@]5([H])C[C@@H](O[C@H]6C[C@@H]([C@H]([C@H](C)O6)O)OC)CC[C@]5(C)[C@@]4([H])CC[C@]23C)=C1 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/oleandrin.html |