Asiatic acid 100mg
Asiatic acid is commonly used in wound healing. Asiatic acid has antioxidant, anti-inflammatory and neuroprotective properties. Asiatic acid derivative synthesis can be used as Anticancer agents; Glycogen phosphorylase inhibitors; Hepatoprotectants.
| Trivial name | Asiatic acid 100mg |
| Catalog Number | A10092-100 |
| Alternative Name(s) | ,(1S,2R,4aS,6aR,6aS,6bR,8aR,9S,10S,11R,12aS,14bR)-10,11-Dihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| Molecular Formula | C30H48O5 |
| CAS# | 464-92-6 |
| SMILES | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@H]([C@@H]([C@@]5(C)CO)O)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/asiatic-acid.html |
