(+)-Camphor
(+)-Camphor is a natural product with anti-inflammatory and analgesic properties.
| Trivial name | D-(+)-Camphor |
| Catalog Number | CSN10753 |
| Alternative Name(s) | D-(+)-Camphor |
| Research Area | / |
| Molecular Formula | C10H16O |
| CAS# | 464-49-3 |
| Purity | ≥98% |
| SMILES | O=C1[C@](C2(C)C)(C)CC[C@]2([H])C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/(+)-camphor.html |
