DL-Carnitine
DL-Carnitine ((±)-Carnitin) is a racemic mixture of L-Carnitine and D-Carnitine that regulates fatty acid transport in the mitochondrion. DL-carnitine is found to be ineffective or toxic, for example, to muscle cells and to the myocardium. DL-Carnitine causes symptoms of myasthenia and cardiac arrhythmias.
| Trivial name | (±)-Carnitin |
| Catalog Number | S5937 |
| Molecular Formula | C7H15NO3 |
| CAS# | 461-06-3, 406-76-8 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | C[N+](C)(C)CC(O)CC([O-])=O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/dl-carnitine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5937-dl-carnitine-chemical-structure.gif |