DL-Carnitine HCl
DL-Carnitine HCl has multiple function as a constituent of striated muscle and liver, an amino acid derivative and an essential cofactor for fatty acid metabolism.
| Trivial name | (±)-Carnitine Chloride |
| Catalog Number | CSN10844 |
| Alternative Name(s) | (±)-Carnitine Chloride |
| Research Area | / |
| Molecular Formula | C7H16ClNO3 |
| CAS# | 461-05-2 |
| Purity | ≥98% |
| SMILES | OC(C[N+](C)(C)C)CC([O-])=O.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/dl-carnitine-hcl.html |