DL-Carnitine hydrochloride 100mg
DL-Carnitine hydrochloride is a quaternary ammonium compound biosynthesized from the amino acids lysine and methionine. In living cells, it is required for the transport of fatty acids from the cytosol into the mitochondria during the breakdown of lipids (fats) for the generation of metabolic energy.
Trivial name | DL-Carnitine hydrochloride 100mg |
Catalog Number | A10322-100 |
Alternative Name(s) | 3-Hydroxy-4-(trimethylammonio)butyrate Hydrochloride |
Molecular Formula | C7H16ClNO3 |
CAS# | 461-05-2 |
SMILES | C[N+](C)(C)CC(CC(=O)[O-])O.Cl |
Size | 100mg |
Supplier Page | http://www.adooq.com/dl-carnitine-hydrochloride.html |