Rucaparib phosphate
Rucaparib phosphate is an inhibitor of PARP with Ki of 1.4 nM for PARP1 in a cell-free assay, also showing binding affinity to eight other PARP domains. Phase 3.
| Trivial name | AG-014699 phosphate, PF-01367338 phosphate |
| Catalog Number | S1098 |
| Molecular Formula | C12H12IN |
| CAS# | 459868-92-9 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | [I-].C[N+]1=CC=C(C=C1)C2=CC=CC=C2 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/AG-014699.html |
| Additional Information | https://file.selleck.cn/downloads/struct/AG-014699-PF-01367338-chemical-structure-S1098.gif |
