NVP-AAM077 Tetrasodium Hydrate 25mg
NVP-AAM077 inhibited progenitor cells proliferation in the subventricular zone and dentate gyrus and reduced the survival of newborn cells in the dentate gyrus in the adult mice.
| Trivial name | NVP-AAM077 Tetrasodium Hydrate 25mg |
| Catalog Number | A14071-25 |
| Alternative Name(s) | (R)-[(S)-1-(4-bromophenyl)-ethylamino]-(2, 3-dioxo-1,2,3,4-tetrahydroquinoxalin-5-yl)-methyl]-phosphonic acid |
| Molecular Formula | N/A |
| CAS# | 459836-30-7 (free base) |
| SMILES | CC(C1=CC=C(C=C1)Br)NC(C2=C3C(=CC=C2)NC(=O)C(=O)N3)P(=O)(O)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/nvp-aam077-tetrasodium-hydrate.html |