I3MT-3
I3MT-3 (HMPSNE, compound 3) is a potent, selective, and cell-membrane permeable inhibitor of 3-mercaptopyruvate sulfurtransferase (3MST) with IC50 of 2.7 μM. I3MT-3 targets a persulfurated cysteine residue located in the active site of 3MST.
| Trivial name | HMPSNE |
| Catalog Number | S3541 |
| Molecular Formula | C17H14N2O2S |
| CAS# | 459420-09-8 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=CC(=O)NC(=N1)SCC(=O)C2=CC=CC3=CC=CC=C23 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/i3mt-3.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3541-i3mt-3-chemical-structure.gif |