Curcumin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01231 |
| Alternative Name(s) | Turmeric extract ;(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| Research Area | Curcumin is a phytopolylphenol pigment isolated from the plant Curcuma longa, commonly known as turmeric, with a variety of pharmacologic properties. Curcumin blocks the formation of reactive-oxygen species, possesses anti-inflammatory properties as a res |
| Molecular Formula | C21H20O6 |
| CAS# | 458-37-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CC(/C=C/C1=CC(OC)=C(O)C=C1)=O)/C=C/C2=CC(OC)=C(O)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01231.html |
| Additional Information | NULL |