Curcumin
Curcumin is a yellow-colored polyphenol obtained from the rhizome of Curcuma longa L. It constitutes an important part of various diets and herbal medicines, especially in the Asian continent for its various salubrious effects on human health.
| Catalog Number | CDC10-0041 |
| Alternative Name(s) | (E,E)-1,7-bis(4-Hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione, Diferuloylmethane, Diferulylmethane, Natural Yellow 3 |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C21H20O6 |
| CAS# | 458-37-7 |
| Inchi | 1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ |
| SMILES | COc1cc(\C=C\C(=O)CC(=O)\C=C\c2ccc(O)c(OC)c2)ccc1O |
| EC Number | 207-280-5 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/curcumin-item-2123.html |