Motesanib (AMG706) 10mM * 1mL in DMSO
Motesanib (AMG706) is a multikinase inhibitor that selectively targets VEGF receptors, platelet-derived growth factor receptors (PDGFRs), and Kit receptors with IC?? values of 2 nM (VEGFR1), 3 nM (VEGFR2), 6 nM (VEGFR3), 84 nM (PDGFR), and 8 nM (Kit).
| Trivial name | Motesanib (AMG706) 10mM * 1mL in DMSO |
| Catalog Number | A11496-10mM-D |
| Alternative Name(s) | N-(2,3-Dihydro-3,3-dimethyl-1H-indol-6-yl)-2-[(4-pyridinylmethyl)amino]-3-pyridinecarboxamide |
| Molecular Formula | C22H23N5O |
| CAS# | 453562-69-1 |
| SMILES | CC1(CNC2=C1C=CC(=C2)NC(=O)C3=C(N=CC=C3)NCC4=CC=NC=C4)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/motesanib-amg706.html |
