Angiotensin II human
Angiotensin II human is a potent vasoconstrictor that induces angiogenesis by activating angiotensin II type 1 (AT1) receptor, which increases the production of vascular endothelial growth factor (VEGF) in a redox-sensitive manner and promotes the formation of capillaries from endothelial cells through the LOX-1-dependent redox-sensitive pathway.
| Catalog Number | E1015 |
| Molecular Formula | C25H19FN2O4S |
| CAS# | 4474-91-3 |
| SMILES | OC1=C(N[S](=O)(=O)C2=CC=C(F)C=C2)C=C(NC(=O)C3=CC=C(C=C3)C4=CC=CC=C4)C=C1 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/angiotensin-II-human.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E1015-Angiotensin-II-human-chemical-structure.png |
