RepSox (SJN 2511) 10mM * 1mL in DMSO
RepSox (SJN 2511) is a selective inhibitor of the TGF-?? type I receptor ALK5 (IC50 values are 0.004 and 0.023 ??M for ALK5 autophosphorylation and ALK5 binding respectively).
| Trivial name | RepSox (SJN 2511) 10mM * 1mL in DMSO |
| Catalog Number | A11762-10mM-D |
| Alternative Name(s) | 2-(3-(6-Methylpyridine-2-yl)-1H-pyr?azol-4-yl)-1,5-naphthyridine |
| Molecular Formula | C17H13N5 |
| CAS# | 446859-33-2 |
| SMILES | CC1=CC=CC(=N1)C2=C(C=NN2)C3=NC4=C(C=C3)N=CC=C4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/repsox-sjn-2511.html |