KIN1400 | MedChemExpress (MCE)
KIN1400 is a potent IRF3 activator. KIN1400 triggers IRF3-dependent innate immune antiviral genes (RIG-I, MDA5, IFIT1, and Mx1) and IFN-β expression. KIN1400 inhibits WNV and DV, two mosquito-borne members of the Flaviviridae and the genus Flavivirus. KIN1400 also inhibits HCV replication. KIN1400 induces innate antiviral immunity through a MAVS-IRF3 axis[1].
| Trivial name | KIN1400 |
| Catalog Number | HY-123805 |
| Research Area | Infection |
| CAS# | 446826-86-4 |
| Purity | ≥98.00% |
| SMILES | OC1=C2N=CC=CC2=CC=C1C(NC3=NC4=CC=CC=C4S3)C5=CC=C(OC(F)F)C=C5 |
| PubChem Chemical Structure ID | 3783668 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/kin1400.html |